About (14R)-1,1-dimethoxy-14-methylhexadec-8-yne
(14R)-1,1-dimethoxy-14-methylhexadec-8-yne (PubChem CID 3085527) has the molecular formula C19H36O2
and a molecular weight of 296.50 g/mol. Its IUPAC name is (14R)-1,1-dimethoxy-14-methylhexadec-8-yne.
Molecular Properties
| Compound Name | (14R)-1,1-dimethoxy-14-methylhexadec-8-yne |
| PubChem CID | 3085527 |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | (14R)-1,1-dimethoxy-14-methylhexadec-8-yne |
| SMILES | CC[C@@H](C)CCCCC#CCCCCCCC(OC)OC |
| InChI | InChI=1S/C19H36O2/c1-5-18(2)16-14-12-10-8-6-7-9-11-13-15-17-19(20-3)21-4/h18-19H,5,7,9-17H2,1-4H3/t18-/m1/s1 |
| InChIKey | CHUDCFHFRGFLQT-GOSISDBHSA-N |
| XLogP | 5.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (14R)-1,1-dimethoxy-14-methylhexadec-8-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (14R)-1,1-dimethoxy-14-methylhexadec-8-yne?
The IUPAC name of (14R)-1,1-dimethoxy-14-methylhexadec-8-yne (CID 3085527) is (14R)-1,1-dimethoxy-14-methylhexadec-8-yne.
What is the SMILES notation for (14R)-1,1-dimethoxy-14-methylhexadec-8-yne?
The canonical SMILES for (14R)-1,1-dimethoxy-14-methylhexadec-8-yne is CC[C@@H](C)CCCCC#CCCCCCCC(OC)OC.
What is the InChIKey of (14R)-1,1-dimethoxy-14-methylhexadec-8-yne?
The InChIKey is CHUDCFHFRGFLQT-GOSISDBHSA-N. The full InChI is InChI=1S/C19H36O2/c1-5-18(2)16-14-12-10-8-6-7-9-11-13-15-17-19(20-3)21-4/h18-19H,5,7,9-17H2,1-4H3/t18-/m1/s1.
What are the key properties of (14R)-1,1-dimethoxy-14-methylhexadec-8-yne?
(14R)-1,1-dimethoxy-14-methylhexadec-8-yne has a molecular weight of 296.50 g/mol, XLogP of 5.56, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (14R)-1,1-dimethoxy-14-methylhexadec-8-yne is sourced from PubChem (CID 3085527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).