About 1-(3,5-dimethylpyrazin-1-ium-1-yl)ethanone
1-(3,5-dimethylpyrazin-1-ium-1-yl)ethanone (PubChem CID 3085845) has the molecular formula C8H11N2O+
and a molecular weight of 151.19 g/mol. Its IUPAC name is 1-(3,5-dimethylpyrazin-1-ium-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3,5-dimethylpyrazin-1-ium-1-yl)ethanone |
| PubChem CID | 3085845 |
| Molecular Formula | C8H11N2O+ |
| Molecular Weight | 151.19 g/mol |
| Exact Mass | 151.09 |
| IUPAC Name | 1-(3,5-dimethylpyrazin-1-ium-1-yl)ethanone |
| SMILES | CC(=O)[n+]1cc(C)nc(C)c1 |
| InChI | InChI=1S/C8H11N2O/c1-6-4-10(8(3)11)5-7(2)9-6/h4-5H,1-3H3/q+1 |
| InChIKey | SRLOIFIDNDAVFM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 33.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.19 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-dimethylpyrazin-1-ium-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dimethylpyrazin-1-ium-1-yl)ethanone?
The IUPAC name of 1-(3,5-dimethylpyrazin-1-ium-1-yl)ethanone (CID 3085845) is 1-(3,5-dimethylpyrazin-1-ium-1-yl)ethanone.
What is the SMILES notation for 1-(3,5-dimethylpyrazin-1-ium-1-yl)ethanone?
The canonical SMILES for 1-(3,5-dimethylpyrazin-1-ium-1-yl)ethanone is CC(=O)[n+]1cc(C)nc(C)c1.
What is the InChIKey of 1-(3,5-dimethylpyrazin-1-ium-1-yl)ethanone?
The InChIKey is SRLOIFIDNDAVFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N2O/c1-6-4-10(8(3)11)5-7(2)9-6/h4-5H,1-3H3/q+1.
What are the key properties of 1-(3,5-dimethylpyrazin-1-ium-1-yl)ethanone?
1-(3,5-dimethylpyrazin-1-ium-1-yl)ethanone has a molecular weight of 151.19 g/mol, XLogP of 0.65, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dimethylpyrazin-1-ium-1-yl)ethanone is sourced from PubChem (CID 3085845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).