C19H18FN3O3S — CID 30859974
N-(2,4-dimethoxyphenyl)-2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]acetamide (PubChem CID 30859974) has the molecular formula C19H18FN3O3S and a molecular weight of 387.44 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 30859974 |
| Molecular Formula | C19H18FN3O3S |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]acetamide |
| SMILES | COc1ccc(NC(=O)Cc2csc(Nc3ccc(F)cc3)n2)c(OC)c1 |
| InChI | InChI=1S/C19H18FN3O3S/c1-25-15-7-8-16(17(10-15)26-2)23-18(24)9-14-11-27-19(22-14)21-13-5-3-12(20)4-6-13/h3-8,10-11H,9H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | ONSCPRMIMWTJME-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |