About [4-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]-(2-fluorophenyl)methanone
[4-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]-(2-fluorophenyl)methanone (PubChem CID 30860479) has the molecular formula C18H20FN3OS
and a molecular weight of 345.44 g/mol. Its IUPAC name is [4-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]-(2-fluorophenyl)methanone.
Molecular Properties
| Compound Name | [4-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]-(2-fluorophenyl)methanone |
| PubChem CID | 30860479 |
| Molecular Formula | C18H20FN3OS |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | [4-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]-(2-fluorophenyl)methanone |
| SMILES | O=C(c1ccccc1F)N1CCN(Cc2nc(C3CC3)cs2)CC1 |
| InChI | InChI=1S/C18H20FN3OS/c19-15-4-2-1-3-14(15)18(23)22-9-7-21(8-10-22)11-17-20-16(12-24-17)13-5-6-13/h1-4,12-13H,5-11H2 |
| InChIKey | YBYNAGYEEHANSD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]-(2-fluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]-(2-fluorophenyl)methanone?
The IUPAC name of [4-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]-(2-fluorophenyl)methanone (CID 30860479) is [4-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]-(2-fluorophenyl)methanone.
What is the SMILES notation for [4-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]-(2-fluorophenyl)methanone?
The canonical SMILES for [4-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]-(2-fluorophenyl)methanone is O=C(c1ccccc1F)N1CCN(Cc2nc(C3CC3)cs2)CC1.
What is the InChIKey of [4-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]-(2-fluorophenyl)methanone?
The InChIKey is YBYNAGYEEHANSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20FN3OS/c19-15-4-2-1-3-14(15)18(23)22-9-7-21(8-10-22)11-17-20-16(12-24-17)13-5-6-13/h1-4,12-13H,5-11H2.
What are the key properties of [4-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]-(2-fluorophenyl)methanone?
[4-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]-(2-fluorophenyl)methanone has a molecular weight of 345.44 g/mol, XLogP of 3.12, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]-(2-fluorophenyl)methanone is sourced from PubChem (CID 30860479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).