About 1,4-dipropylpiperazine
1,4-dipropylpiperazine (PubChem CID 3086049) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is 1,4-dipropylpiperazine.
Molecular Properties
| Compound Name | 1,4-dipropylpiperazine |
| PubChem CID | 3086049 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 1,4-dipropylpiperazine |
| SMILES | CCCN1CCN(CCC)CC1 |
| InChI | InChI=1S/C10H22N2/c1-3-5-11-7-9-12(6-4-2)10-8-11/h3-10H2,1-2H3 |
| InChIKey | IVMKBBDVVDYGPS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-dipropylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dipropylpiperazine?
The IUPAC name of 1,4-dipropylpiperazine (CID 3086049) is 1,4-dipropylpiperazine.
What is the SMILES notation for 1,4-dipropylpiperazine?
The canonical SMILES for 1,4-dipropylpiperazine is CCCN1CCN(CCC)CC1.
What is the InChIKey of 1,4-dipropylpiperazine?
The InChIKey is IVMKBBDVVDYGPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2/c1-3-5-11-7-9-12(6-4-2)10-8-11/h3-10H2,1-2H3.
What are the key properties of 1,4-dipropylpiperazine?
1,4-dipropylpiperazine has a molecular weight of 170.30 g/mol, XLogP of 1.42, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dipropylpiperazine is sourced from PubChem (CID 3086049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).