C22H19N7O4S — CID 30862775
N-[3-[3-cyclopropyl-5-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,2,4-triazol-4-yl]phenyl]acetamide (PubChem CID 30862775) has the molecular formula C22H19N7O4S and a molecular weight of 477.51 g/mol. Its IUPAC name is N-[3-[3-cyclopropyl-5-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,2,4-triazol-4-yl]phenyl]acetamide.
| Compound Name | N-[3-[3-cyclopropyl-5-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,2,4-triazol-4-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 30862775 |
| Molecular Formula | C22H19N7O4S |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | N-[3-[3-cyclopropyl-5-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,2,4-triazol-4-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-n2c(SCc3nnc(-c4ccc([N+](=O)[O-])cc4)o3)nnc2C2CC2)c1 |
| InChI | InChI=1S/C22H19N7O4S/c1-13(30)23-16-3-2-4-18(11-16)28-20(14-5-6-14)25-27-22(28)34-12-19-24-26-21(33-19)15-7-9-17(10-8-15)29(31)32/h2-4,7-11,14H,5-6,12H2,1H3,(H,23,30) |
| InChIKey | JYTPJTZVBRLBDE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 141.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|