C19H20N4S2 — CID 30863381
2-benzylsulfanyl-5-(4-phenylpiperazin-1-yl)-1,3,4-thiadiazole (PubChem CID 30863381) has the molecular formula C19H20N4S2 and a molecular weight of 368.53 g/mol. Its IUPAC name is 2-benzylsulfanyl-5-(4-phenylpiperazin-1-yl)-1,3,4-thiadiazole.
| Compound Name | 2-benzylsulfanyl-5-(4-phenylpiperazin-1-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 30863381 |
| Molecular Formula | C19H20N4S2 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 2-benzylsulfanyl-5-(4-phenylpiperazin-1-yl)-1,3,4-thiadiazole |
| SMILES | c1ccc(CSc2nnc(N3CCN(c4ccccc4)CC3)s2)cc1 |
| InChI | InChI=1S/C19H20N4S2/c1-3-7-16(8-4-1)15-24-19-21-20-18(25-19)23-13-11-22(12-14-23)17-9-5-2-6-10-17/h1-10H,11-15H2 |
| InChIKey | GLBPVZVTZIKQKE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |