C23H20Cl2N4S — CID 3086356
4-[(5,6-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-methyl-N-(3-phenylpropyl)aniline (PubChem CID 3086356) has the molecular formula C23H20Cl2N4S and a molecular weight of 455.41 g/mol. Its IUPAC name is 4-[(5,6-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-methyl-N-(3-phenylpropyl)aniline.
| Compound Name | 4-[(5,6-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-methyl-N-(3-phenylpropyl)aniline |
|---|---|
| PubChem CID | 3086356 |
| Molecular Formula | C23H20Cl2N4S |
| Molecular Weight | 455.41 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 4-[(5,6-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-methyl-N-(3-phenylpropyl)aniline |
| SMILES | CN(CCCc1ccccc1)c1ccc(/N=N/c2nc3cc(Cl)c(Cl)cc3s2)cc1 |
| InChI | InChI=1S/C23H20Cl2N4S/c1-29(13-5-8-16-6-3-2-4-7-16)18-11-9-17(10-12-18)27-28-23-26-21-14-19(24)20(25)15-22(21)30-23/h2-4,6-7,9-12,14-15H,5,8,13H2,1H3/b28-27+ |
| InChIKey | VCTPQXYCVZZODD-BYYHNAKLSA-N |
| XLogP | 8.09 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.41 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|