C14H24O — CID 3086472
(3aR,4R,6R,7R,7aS)-6-methoxy-3,4,6,7-tetramethyl-1,3a,4,5,7,7a-hexahydroindene (PubChem CID 3086472) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is (3aR,4R,6R,7R,7aS)-6-methoxy-3,4,6,7-tetramethyl-1,3a,4,5,7,7a-hexahydroindene.
| Compound Name | (3aR,4R,6R,7R,7aS)-6-methoxy-3,4,6,7-tetramethyl-1,3a,4,5,7,7a-hexahydroindene |
|---|---|
| PubChem CID | 3086472 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (3aR,4R,6R,7R,7aS)-6-methoxy-3,4,6,7-tetramethyl-1,3a,4,5,7,7a-hexahydroindene |
| SMILES | CO[C@]1(C)C[C@@H](C)[C@H]2C(C)=CC[C@@H]2[C@H]1C |
| InChI | InChI=1S/C14H24O/c1-9-6-7-12-11(3)14(4,15-5)8-10(2)13(9)12/h6,10-13H,7-8H2,1-5H3/t10-,11-,12-,13-,14-/m1/s1 |
| InChIKey | FUQRHLOGXXEQMO-DHGKCCLASA-N |
| XLogP | 3.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|