About N-(1,3-benzodioxol-5-yl)-4,5-dihydro-1H-imidazol-2-amine
N-(1,3-benzodioxol-5-yl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 3086489) has the molecular formula C10H11N3O2
and a molecular weight of 205.22 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-4,5-dihydro-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | N-(1,3-benzodioxol-5-yl)-4,5-dihydro-1H-imidazol-2-amine |
| PubChem CID | 3086489 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | c1cc2c(cc1NC1=NCCN1)OCO2 |
| InChI | InChI=1S/C10H11N3O2/c1-2-8-9(15-6-14-8)5-7(1)13-10-11-3-4-12-10/h1-2,5H,3-4,6H2,(H2,11,12,13) |
| InChIKey | YSPUUFZLWUWKHF-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1,3-benzodioxol-5-yl)-4,5-dihydro-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzodioxol-5-yl)-4,5-dihydro-1H-imidazol-2-amine?
The IUPAC name of N-(1,3-benzodioxol-5-yl)-4,5-dihydro-1H-imidazol-2-amine (CID 3086489) is N-(1,3-benzodioxol-5-yl)-4,5-dihydro-1H-imidazol-2-amine.
What is the SMILES notation for N-(1,3-benzodioxol-5-yl)-4,5-dihydro-1H-imidazol-2-amine?
The canonical SMILES for N-(1,3-benzodioxol-5-yl)-4,5-dihydro-1H-imidazol-2-amine is c1cc2c(cc1NC1=NCCN1)OCO2.
What is the InChIKey of N-(1,3-benzodioxol-5-yl)-4,5-dihydro-1H-imidazol-2-amine?
The InChIKey is YSPUUFZLWUWKHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2/c1-2-8-9(15-6-14-8)5-7(1)13-10-11-3-4-12-10/h1-2,5H,3-4,6H2,(H2,11,12,13).
What are the key properties of N-(1,3-benzodioxol-5-yl)-4,5-dihydro-1H-imidazol-2-amine?
N-(1,3-benzodioxol-5-yl)-4,5-dihydro-1H-imidazol-2-amine has a molecular weight of 205.22 g/mol, XLogP of 0.79, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzodioxol-5-yl)-4,5-dihydro-1H-imidazol-2-amine is sourced from PubChem (CID 3086489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).