C19H24O5 — CID 3086528
5-[2-(3,4-dimethoxyphenyl)ethyl]-1,2,3-trimethoxybenzene (PubChem CID 3086528) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is 5-[2-(3,4-dimethoxyphenyl)ethyl]-1,2,3-trimethoxybenzene.
| Compound Name | 5-[2-(3,4-dimethoxyphenyl)ethyl]-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 3086528 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 5-[2-(3,4-dimethoxyphenyl)ethyl]-1,2,3-trimethoxybenzene |
| SMILES | COc1ccc(CCc2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C19H24O5/c1-20-15-9-8-13(10-16(15)21-2)6-7-14-11-17(22-3)19(24-5)18(12-14)23-4/h8-12H,6-7H2,1-5H3 |
| InChIKey | XKKZNLRWNSUNBW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |