About 3-[(4-fluorophenyl)methoxy]-N-(1H-1,2,4-triazol-5-yl)benzamide
3-[(4-fluorophenyl)methoxy]-N-(1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 30865619) has the molecular formula C16H13FN4O2
and a molecular weight of 312.30 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methoxy]-N-(1H-1,2,4-triazol-5-yl)benzamide.
Molecular Properties
| Compound Name | 3-[(4-fluorophenyl)methoxy]-N-(1H-1,2,4-triazol-5-yl)benzamide |
| PubChem CID | 30865619 |
| Molecular Formula | C16H13FN4O2 |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 3-[(4-fluorophenyl)methoxy]-N-(1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | O=C(Nc1ncn[nH]1)c1cccc(OCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C16H13FN4O2/c17-13-6-4-11(5-7-13)9-23-14-3-1-2-12(8-14)15(22)20-16-18-10-19-21-16/h1-8,10H,9H2,(H2,18,19,20,21,22) |
| InChIKey | QIPNFDGYPCBGFC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4-fluorophenyl)methoxy]-N-(1H-1,2,4-triazol-5-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-fluorophenyl)methoxy]-N-(1H-1,2,4-triazol-5-yl)benzamide?
The IUPAC name of 3-[(4-fluorophenyl)methoxy]-N-(1H-1,2,4-triazol-5-yl)benzamide (CID 30865619) is 3-[(4-fluorophenyl)methoxy]-N-(1H-1,2,4-triazol-5-yl)benzamide.
What is the SMILES notation for 3-[(4-fluorophenyl)methoxy]-N-(1H-1,2,4-triazol-5-yl)benzamide?
The canonical SMILES for 3-[(4-fluorophenyl)methoxy]-N-(1H-1,2,4-triazol-5-yl)benzamide is O=C(Nc1ncn[nH]1)c1cccc(OCc2ccc(F)cc2)c1.
What is the InChIKey of 3-[(4-fluorophenyl)methoxy]-N-(1H-1,2,4-triazol-5-yl)benzamide?
The InChIKey is QIPNFDGYPCBGFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13FN4O2/c17-13-6-4-11(5-7-13)9-23-14-3-1-2-12(8-14)15(22)20-16-18-10-19-21-16/h1-8,10H,9H2,(H2,18,19,20,21,22).
What are the key properties of 3-[(4-fluorophenyl)methoxy]-N-(1H-1,2,4-triazol-5-yl)benzamide?
3-[(4-fluorophenyl)methoxy]-N-(1H-1,2,4-triazol-5-yl)benzamide has a molecular weight of 312.30 g/mol, XLogP of 2.78, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-fluorophenyl)methoxy]-N-(1H-1,2,4-triazol-5-yl)benzamide is sourced from PubChem (CID 30865619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).