About 13-hydroxy-N,N-dimethyltridecanamide
13-hydroxy-N,N-dimethyltridecanamide (PubChem CID 3086631) has the molecular formula C15H31NO2
and a molecular weight of 257.42 g/mol. Its IUPAC name is 13-hydroxy-N,N-dimethyltridecanamide.
Molecular Properties
| Compound Name | 13-hydroxy-N,N-dimethyltridecanamide |
| PubChem CID | 3086631 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | 13-hydroxy-N,N-dimethyltridecanamide |
| SMILES | CN(C)C(=O)CCCCCCCCCCCCO |
| InChI | InChI=1S/C15H31NO2/c1-16(2)15(18)13-11-9-7-5-3-4-6-8-10-12-14-17/h17H,3-14H2,1-2H3 |
| InChIKey | YWPSCECSGOKQRM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 13-hydroxy-N,N-dimethyltridecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 13-hydroxy-N,N-dimethyltridecanamide?
The IUPAC name of 13-hydroxy-N,N-dimethyltridecanamide (CID 3086631) is 13-hydroxy-N,N-dimethyltridecanamide.
What is the SMILES notation for 13-hydroxy-N,N-dimethyltridecanamide?
The canonical SMILES for 13-hydroxy-N,N-dimethyltridecanamide is CN(C)C(=O)CCCCCCCCCCCCO.
What is the InChIKey of 13-hydroxy-N,N-dimethyltridecanamide?
The InChIKey is YWPSCECSGOKQRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO2/c1-16(2)15(18)13-11-9-7-5-3-4-6-8-10-12-14-17/h17H,3-14H2,1-2H3.
What are the key properties of 13-hydroxy-N,N-dimethyltridecanamide?
13-hydroxy-N,N-dimethyltridecanamide has a molecular weight of 257.42 g/mol, XLogP of 3.36, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 13-hydroxy-N,N-dimethyltridecanamide is sourced from PubChem (CID 3086631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).