C24H29NO6 — CID 3086755
2,3-dimethoxy-5-methyl-6-(5-morpholin-4-yl-5-oxo-1-phenylpentyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 3086755) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2,3-dimethoxy-5-methyl-6-(5-morpholin-4-yl-5-oxo-1-phenylpentyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3-dimethoxy-5-methyl-6-(5-morpholin-4-yl-5-oxo-1-phenylpentyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 3086755 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 2,3-dimethoxy-5-methyl-6-(5-morpholin-4-yl-5-oxo-1-phenylpentyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C(C(CCCC(=O)N2CCOCC2)c2ccccc2)=C(C)C1=O |
| InChI | InChI=1S/C24H29NO6/c1-16-20(22(28)24(30-3)23(29-2)21(16)27)18(17-8-5-4-6-9-17)10-7-11-19(26)25-12-14-31-15-13-25/h4-6,8-9,18H,7,10-15H2,1-3H3 |
| InChIKey | JZNNZUSJYKWKEA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|