C10H18Br4N4S2 — CID 3086774
N,N'-bis[5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]ethane-1,2-diamine;dihydrobromide (PubChem CID 3086774) has the molecular formula C10H18Br4N4S2 and a molecular weight of 578.03 g/mol. Its IUPAC name is N,N'-bis[5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]ethane-1,2-diamine;dihydrobromide.
| Compound Name | N,N'-bis[5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]ethane-1,2-diamine;dihydrobromide |
|---|---|
| PubChem CID | 3086774 |
| Molecular Formula | C10H18Br4N4S2 |
| Molecular Weight | 578.03 g/mol |
| Exact Mass | 573.77 |
| IUPAC Name | N,N'-bis[5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]ethane-1,2-diamine;dihydrobromide |
| SMILES | Br.Br.BrCC1CN=C(NCCNC2=NCC(CBr)S2)S1 |
| InChI | InChI=1S/C10H16Br2N4S2.2BrH/c11-3-7-5-15-9(17-7)13-1-2-14-10-16-6-8(4-12)18-10;;/h7-8H,1-6H2,(H,13,15)(H,14,16);2*1H |
| InChIKey | HINORRCNCGSHCQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.03 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|