About copper(1+);N-(2-ethenoxyethyl)carbamodithioate
copper(1+);N-(2-ethenoxyethyl)carbamodithioate (PubChem CID 3086791) has the molecular formula C5H8CuNOS2
and a molecular weight of 225.80 g/mol. Its IUPAC name is copper(1+);N-(2-ethenoxyethyl)carbamodithioate.
Molecular Properties
| Compound Name | copper(1+);N-(2-ethenoxyethyl)carbamodithioate |
| PubChem CID | 3086791 |
| Molecular Formula | C5H8CuNOS2 |
| Molecular Weight | 225.80 g/mol |
| Exact Mass | 224.93 |
| IUPAC Name | copper(1+);N-(2-ethenoxyethyl)carbamodithioate |
| SMILES | C=COCCNC(=S)[S-].[Cu+] |
| InChI | InChI=1S/C5H9NOS2.Cu/c1-2-7-4-3-6-5(8)9;/h2H,1,3-4H2,(H2,6,8,9);/q;+1/p-1 |
| InChIKey | RFTNVUZEWPKGQT-UHFFFAOYSA-M |
| XLogP | 0.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.80 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);N-(2-ethenoxyethyl)carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);N-(2-ethenoxyethyl)carbamodithioate?
The IUPAC name of copper(1+);N-(2-ethenoxyethyl)carbamodithioate (CID 3086791) is copper(1+);N-(2-ethenoxyethyl)carbamodithioate.
What is the SMILES notation for copper(1+);N-(2-ethenoxyethyl)carbamodithioate?
The canonical SMILES for copper(1+);N-(2-ethenoxyethyl)carbamodithioate is C=COCCNC(=S)[S-].[Cu+].
What is the InChIKey of copper(1+);N-(2-ethenoxyethyl)carbamodithioate?
The InChIKey is RFTNVUZEWPKGQT-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H9NOS2.Cu/c1-2-7-4-3-6-5(8)9;/h2H,1,3-4H2,(H2,6,8,9);/q;+1/p-1.
What are the key properties of copper(1+);N-(2-ethenoxyethyl)carbamodithioate?
copper(1+);N-(2-ethenoxyethyl)carbamodithioate has a molecular weight of 225.80 g/mol, XLogP of 0.57, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);N-(2-ethenoxyethyl)carbamodithioate is sourced from PubChem (CID 3086791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).