C22H22N6O2S — CID 30868129
N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]-1,2-dihydroacenaphthylene-3-sulfonamide (PubChem CID 30868129) has the molecular formula C22H22N6O2S and a molecular weight of 434.53 g/mol. Its IUPAC name is N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]-1,2-dihydroacenaphthylene-3-sulfonamide.
| Compound Name | N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]-1,2-dihydroacenaphthylene-3-sulfonamide |
|---|---|
| PubChem CID | 30868129 |
| Molecular Formula | C22H22N6O2S |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]-1,2-dihydroacenaphthylene-3-sulfonamide |
| SMILES | Cc1nc(NCCNS(=O)(=O)c2ccc3cccc4c3c2CC4)cc(-n2cccn2)n1 |
| InChI | InChI=1S/C22H22N6O2S/c1-15-26-20(14-21(27-15)28-13-3-10-24-28)23-11-12-25-31(29,30)19-9-7-17-5-2-4-16-6-8-18(19)22(16)17/h2-5,7,9-10,13-14,25H,6,8,11-12H2,1H3,(H,23,26,27) |
| InChIKey | AZRBDUABLRYZNH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|