C18H15FN2O — CID 30868595
6-(4-fluorophenyl)-3-[(2-methylphenyl)methyl]pyrimidin-4-one (PubChem CID 30868595) has the molecular formula C18H15FN2O and a molecular weight of 294.33 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-3-[(2-methylphenyl)methyl]pyrimidin-4-one.
| Compound Name | 6-(4-fluorophenyl)-3-[(2-methylphenyl)methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 30868595 |
| Molecular Formula | C18H15FN2O |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 6-(4-fluorophenyl)-3-[(2-methylphenyl)methyl]pyrimidin-4-one |
| SMILES | Cc1ccccc1Cn1cnc(-c2ccc(F)cc2)cc1=O |
| InChI | InChI=1S/C18H15FN2O/c1-13-4-2-3-5-15(13)11-21-12-20-17(10-18(21)22)14-6-8-16(19)9-7-14/h2-10,12H,11H2,1H3 |
| InChIKey | NNQUATMWUFUOSJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |