C11H14N4O2 — CID 3086956
5-amino-1,3-diethylpyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 3086956) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 5-amino-1,3-diethylpyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 5-amino-1,3-diethylpyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3086956 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 5-amino-1,3-diethylpyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | CCn1c(=O)c2c(N)ccnc2n(CC)c1=O |
| InChI | InChI=1S/C11H14N4O2/c1-3-14-9-8(7(12)5-6-13-9)10(16)15(4-2)11(14)17/h5-6H,3-4H2,1-2H3,(H2,12,13) |
| InChIKey | IZDBQAXCNBOTKC-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 82.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |