C20H28N2 — CID 3087102
N-heptyl-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 3087102) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is N-heptyl-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | N-heptyl-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 3087102 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | N-heptyl-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | CCCCCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C20H28N2/c1-2-3-4-5-10-15-21-20-16-11-6-8-13-18(16)22-19-14-9-7-12-17(19)20/h6,8,11,13H,2-5,7,9-10,12,14-15H2,1H3,(H,21,22) |
| InChIKey | HQRYMINYXXVYNF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|