About 3-(benzotriazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide
3-(benzotriazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide (PubChem CID 3087146) has the molecular formula C17H10N4O2S2
and a molecular weight of 366.43 g/mol. Its IUPAC name is 3-(benzotriazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide.
Molecular Properties
| Compound Name | 3-(benzotriazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide |
| PubChem CID | 3087146 |
| Molecular Formula | C17H10N4O2S2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 3-(benzotriazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide |
| SMILES | O=S1(=O)N=C(n2nnc3ccccc32)c2sc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C17H10N4O2S2/c22-25(23)15-10-14(11-6-2-1-3-7-11)24-16(15)17(19-25)21-13-9-5-4-8-12(13)18-20-21/h1-10H |
| InChIKey | DHADUOSCVDGLAA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 77.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(benzotriazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzotriazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide?
The IUPAC name of 3-(benzotriazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide (CID 3087146) is 3-(benzotriazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide.
What is the SMILES notation for 3-(benzotriazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide?
The canonical SMILES for 3-(benzotriazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide is O=S1(=O)N=C(n2nnc3ccccc32)c2sc(-c3ccccc3)cc21.
What is the InChIKey of 3-(benzotriazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide?
The InChIKey is DHADUOSCVDGLAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10N4O2S2/c22-25(23)15-10-14(11-6-2-1-3-7-11)24-16(15)17(19-25)21-13-9-5-4-8-12(13)18-20-21/h1-10H.
What are the key properties of 3-(benzotriazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide?
3-(benzotriazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide has a molecular weight of 366.43 g/mol, XLogP of 3.16, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzotriazol-1-yl)-5-phenylthieno[2,3-d][1,2]thiazole 1,1-dioxide is sourced from PubChem (CID 3087146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).