C24H44N4O2 — CID 3087258
2,5-bis[3-(dipropylamino)propylamino]cyclohexa-2,5-diene-1,4-dione (PubChem CID 3087258) has the molecular formula C24H44N4O2 and a molecular weight of 420.64 g/mol. Its IUPAC name is 2,5-bis[3-(dipropylamino)propylamino]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis[3-(dipropylamino)propylamino]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 3087258 |
| Molecular Formula | C24H44N4O2 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.35 |
| IUPAC Name | 2,5-bis[3-(dipropylamino)propylamino]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCN(CCC)CCCNC1=CC(=O)C(NCCCN(CCC)CCC)=CC1=O |
| InChI | InChI=1S/C24H44N4O2/c1-5-13-27(14-6-2)17-9-11-25-21-19-24(30)22(20-23(21)29)26-12-10-18-28(15-7-3)16-8-4/h19-20,25-26H,5-18H2,1-4H3 |
| InChIKey | NMTSAOSNTIQCEW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|