About 4-fluoro-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide
4-fluoro-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide (PubChem CID 30873197) has the molecular formula C16H13FN4O
and a molecular weight of 296.31 g/mol. Its IUPAC name is 4-fluoro-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide.
Molecular Properties
| Compound Name | 4-fluoro-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide |
| PubChem CID | 30873197 |
| Molecular Formula | C16H13FN4O |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 4-fluoro-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(Cn2cncn2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H13FN4O/c17-14-5-3-13(4-6-14)16(22)20-15-7-1-12(2-8-15)9-21-11-18-10-19-21/h1-8,10-11H,9H2,(H,20,22) |
| InChIKey | YCLAUVBNQWQYIB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-fluoro-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide?
The IUPAC name of 4-fluoro-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide (CID 30873197) is 4-fluoro-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide.
What is the SMILES notation for 4-fluoro-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide?
The canonical SMILES for 4-fluoro-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide is O=C(Nc1ccc(Cn2cncn2)cc1)c1ccc(F)cc1.
What is the InChIKey of 4-fluoro-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide?
The InChIKey is YCLAUVBNQWQYIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13FN4O/c17-14-5-3-13(4-6-14)16(22)20-15-7-1-12(2-8-15)9-21-11-18-10-19-21/h1-8,10-11H,9H2,(H,20,22).
What are the key properties of 4-fluoro-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide?
4-fluoro-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide has a molecular weight of 296.31 g/mol, XLogP of 2.72, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide is sourced from PubChem (CID 30873197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).