About 3-methyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide
3-methyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide (PubChem CID 30873243) has the molecular formula C17H16N4O
and a molecular weight of 292.34 g/mol. Its IUPAC name is 3-methyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide.
Molecular Properties
| Compound Name | 3-methyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide |
| PubChem CID | 30873243 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-methyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(Cn3cncn3)cc2)c1 |
| InChI | InChI=1S/C17H16N4O/c1-13-3-2-4-15(9-13)17(22)20-16-7-5-14(6-8-16)10-21-12-18-11-19-21/h2-9,11-12H,10H2,1H3,(H,20,22) |
| InChIKey | BEEWVQRSBMNMAX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide?
The IUPAC name of 3-methyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide (CID 30873243) is 3-methyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide.
What is the SMILES notation for 3-methyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide?
The canonical SMILES for 3-methyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide is Cc1cccc(C(=O)Nc2ccc(Cn3cncn3)cc2)c1.
What is the InChIKey of 3-methyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide?
The InChIKey is BEEWVQRSBMNMAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O/c1-13-3-2-4-15(9-13)17(22)20-16-7-5-14(6-8-16)10-21-12-18-11-19-21/h2-9,11-12H,10H2,1H3,(H,20,22).
What are the key properties of 3-methyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide?
3-methyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide has a molecular weight of 292.34 g/mol, XLogP of 2.89, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzamide is sourced from PubChem (CID 30873243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).