C18H15N3O2S — CID 3087435
6-[2-(4-methylanilino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 3087435) has the molecular formula C18H15N3O2S and a molecular weight of 337.40 g/mol. Its IUPAC name is 6-[2-(4-methylanilino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(4-methylanilino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 3087435 |
| Molecular Formula | C18H15N3O2S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 6-[2-(4-methylanilino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc(Nc2nc(-c3ccc4c(c3)NC(=O)CO4)cs2)cc1 |
| InChI | InChI=1S/C18H15N3O2S/c1-11-2-5-13(6-3-11)19-18-21-15(10-24-18)12-4-7-16-14(8-12)20-17(22)9-23-16/h2-8,10H,9H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | BWWHBDMPQPUBCD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |