About 6-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,4-benzoxazin-3-one
6-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,4-benzoxazin-3-one (PubChem CID 3087438) has the molecular formula C12H11N3O2S
and a molecular weight of 261.31 g/mol. Its IUPAC name is 6-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 6-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,4-benzoxazin-3-one |
| PubChem CID | 3087438 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 6-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,4-benzoxazin-3-one |
| SMILES | CN1C(=O)COc2ccc(-c3csc(N)n3)cc21 |
| InChI | InChI=1S/C12H11N3O2S/c1-15-9-4-7(8-6-18-12(13)14-8)2-3-10(9)17-5-11(15)16/h2-4,6H,5H2,1H3,(H2,13,14) |
| InChIKey | STHIZLTYZQLTNT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,4-benzoxazin-3-one?
The IUPAC name of 6-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,4-benzoxazin-3-one (CID 3087438) is 6-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,4-benzoxazin-3-one.
What is the SMILES notation for 6-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,4-benzoxazin-3-one?
The canonical SMILES for 6-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,4-benzoxazin-3-one is CN1C(=O)COc2ccc(-c3csc(N)n3)cc21.
What is the InChIKey of 6-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,4-benzoxazin-3-one?
The InChIKey is STHIZLTYZQLTNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O2S/c1-15-9-4-7(8-6-18-12(13)14-8)2-3-10(9)17-5-11(15)16/h2-4,6H,5H2,1H3,(H2,13,14).
What are the key properties of 6-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,4-benzoxazin-3-one?
6-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,4-benzoxazin-3-one has a molecular weight of 261.31 g/mol, XLogP of 1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,4-benzoxazin-3-one is sourced from PubChem (CID 3087438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).