C17H16N2O3 — CID 30874438
N-[4-(cyanomethoxy)phenyl]-2-(3-methoxyphenyl)acetamide (PubChem CID 30874438) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is N-[4-(cyanomethoxy)phenyl]-2-(3-methoxyphenyl)acetamide.
| Compound Name | N-[4-(cyanomethoxy)phenyl]-2-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 30874438 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-[4-(cyanomethoxy)phenyl]-2-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(CC(=O)Nc2ccc(OCC#N)cc2)c1 |
| InChI | InChI=1S/C17H16N2O3/c1-21-16-4-2-3-13(11-16)12-17(20)19-14-5-7-15(8-6-14)22-10-9-18/h2-8,11H,10,12H2,1H3,(H,19,20) |
| InChIKey | XMEIGZNGVKGVKN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |