About 1-methyl-5-phenyl-5,6-dihydro-4H-pyrimidine;hydrochloride
1-methyl-5-phenyl-5,6-dihydro-4H-pyrimidine;hydrochloride (PubChem CID 3087477) has the molecular formula C11H15ClN2
and a molecular weight of 210.71 g/mol. Its IUPAC name is 1-methyl-5-phenyl-5,6-dihydro-4H-pyrimidine;hydrochloride.
Molecular Properties
| Compound Name | 1-methyl-5-phenyl-5,6-dihydro-4H-pyrimidine;hydrochloride |
| PubChem CID | 3087477 |
| Molecular Formula | C11H15ClN2 |
| Molecular Weight | 210.71 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 1-methyl-5-phenyl-5,6-dihydro-4H-pyrimidine;hydrochloride |
| SMILES | CN1C=NCC(c2ccccc2)C1.Cl |
| InChI | InChI=1S/C11H14N2.ClH/c1-13-8-11(7-12-9-13)10-5-3-2-4-6-10;/h2-6,9,11H,7-8H2,1H3;1H |
| InChIKey | VIXTVRMXGDUSLG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.71 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-5-phenyl-5,6-dihydro-4H-pyrimidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-phenyl-5,6-dihydro-4H-pyrimidine;hydrochloride?
The IUPAC name of 1-methyl-5-phenyl-5,6-dihydro-4H-pyrimidine;hydrochloride (CID 3087477) is 1-methyl-5-phenyl-5,6-dihydro-4H-pyrimidine;hydrochloride.
What is the SMILES notation for 1-methyl-5-phenyl-5,6-dihydro-4H-pyrimidine;hydrochloride?
The canonical SMILES for 1-methyl-5-phenyl-5,6-dihydro-4H-pyrimidine;hydrochloride is CN1C=NCC(c2ccccc2)C1.Cl.
What is the InChIKey of 1-methyl-5-phenyl-5,6-dihydro-4H-pyrimidine;hydrochloride?
The InChIKey is VIXTVRMXGDUSLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2.ClH/c1-13-8-11(7-12-9-13)10-5-3-2-4-6-10;/h2-6,9,11H,7-8H2,1H3;1H.
What are the key properties of 1-methyl-5-phenyl-5,6-dihydro-4H-pyrimidine;hydrochloride?
1-methyl-5-phenyl-5,6-dihydro-4H-pyrimidine;hydrochloride has a molecular weight of 210.71 g/mol, XLogP of 2.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-phenyl-5,6-dihydro-4H-pyrimidine;hydrochloride is sourced from PubChem (CID 3087477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).