C11H10N2O2 — CID 3087509
7-hydroxy-2,4,4a,5-tetrahydroindeno[1,2-c]pyridazin-3-one (PubChem CID 3087509) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 7-hydroxy-2,4,4a,5-tetrahydroindeno[1,2-c]pyridazin-3-one.
| Compound Name | 7-hydroxy-2,4,4a,5-tetrahydroindeno[1,2-c]pyridazin-3-one |
|---|---|
| PubChem CID | 3087509 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 7-hydroxy-2,4,4a,5-tetrahydroindeno[1,2-c]pyridazin-3-one |
| SMILES | O=C1CC2Cc3cc(O)ccc3C2=NN1 |
| InChI | InChI=1S/C11H10N2O2/c14-8-1-2-9-6(4-8)3-7-5-10(15)12-13-11(7)9/h1-2,4,7,14H,3,5H2,(H,12,15) |
| InChIKey | HRUFLRSTTUAWHE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'} |
|---|