C22H35N3O2 — CID 30876916
(1R,2R)-1-[methyl(4-morpholin-4-ylbutyl)amino]spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol (PubChem CID 30876916) has the molecular formula C22H35N3O2 and a molecular weight of 373.54 g/mol. Its IUPAC name is (1R,2R)-1-[methyl(4-morpholin-4-ylbutyl)amino]spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol.
| Compound Name | (1R,2R)-1-[methyl(4-morpholin-4-ylbutyl)amino]spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol |
|---|---|
| PubChem CID | 30876916 |
| Molecular Formula | C22H35N3O2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.27 |
| IUPAC Name | (1R,2R)-1-[methyl(4-morpholin-4-ylbutyl)amino]spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol |
| SMILES | CN(CCCCN1CCOCC1)[C@@H]1c2ccccc2C2(CCNCC2)[C@H]1O |
| InChI | InChI=1S/C22H35N3O2/c1-24(12-4-5-13-25-14-16-27-17-15-25)20-18-6-2-3-7-19(18)22(21(20)26)8-10-23-11-9-22/h2-3,6-7,20-21,23,26H,4-5,8-17H2,1H3/t20-,21+/m1/s1 |
| InChIKey | IIVOIQPRMLOWNJ-RTWAWAEBSA-N |
| XLogP | 1.77 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|