About 2-phenyl-2-propyl-1,3-thiazolidine
2-phenyl-2-propyl-1,3-thiazolidine (PubChem CID 3087733) has the molecular formula C12H17NS
and a molecular weight of 207.34 g/mol. Its IUPAC name is 2-phenyl-2-propyl-1,3-thiazolidine.
Molecular Properties
| Compound Name | 2-phenyl-2-propyl-1,3-thiazolidine |
| PubChem CID | 3087733 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2-phenyl-2-propyl-1,3-thiazolidine |
| SMILES | CCCC1(c2ccccc2)NCCS1 |
| InChI | InChI=1S/C12H17NS/c1-2-8-12(13-9-10-14-12)11-6-4-3-5-7-11/h3-7,13H,2,8-10H2,1H3 |
| InChIKey | SXLITDTVXZWHGU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenyl-2-propyl-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-2-propyl-1,3-thiazolidine?
The IUPAC name of 2-phenyl-2-propyl-1,3-thiazolidine (CID 3087733) is 2-phenyl-2-propyl-1,3-thiazolidine.
What is the SMILES notation for 2-phenyl-2-propyl-1,3-thiazolidine?
The canonical SMILES for 2-phenyl-2-propyl-1,3-thiazolidine is CCCC1(c2ccccc2)NCCS1.
What is the InChIKey of 2-phenyl-2-propyl-1,3-thiazolidine?
The InChIKey is SXLITDTVXZWHGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NS/c1-2-8-12(13-9-10-14-12)11-6-4-3-5-7-11/h3-7,13H,2,8-10H2,1H3.
What are the key properties of 2-phenyl-2-propyl-1,3-thiazolidine?
2-phenyl-2-propyl-1,3-thiazolidine has a molecular weight of 207.34 g/mol, XLogP of 2.98, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-2-propyl-1,3-thiazolidine is sourced from PubChem (CID 3087733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).