About 5-methyl-2-nonyl-1,3-thiazolidine
5-methyl-2-nonyl-1,3-thiazolidine (PubChem CID 3087737) has the molecular formula C13H27NS
and a molecular weight of 229.43 g/mol. Its IUPAC name is 5-methyl-2-nonyl-1,3-thiazolidine.
Molecular Properties
| Compound Name | 5-methyl-2-nonyl-1,3-thiazolidine |
| PubChem CID | 3087737 |
| Molecular Formula | C13H27NS |
| Molecular Weight | 229.43 g/mol |
| Exact Mass | 229.19 |
| IUPAC Name | 5-methyl-2-nonyl-1,3-thiazolidine |
| SMILES | CCCCCCCCCC1NCC(C)S1 |
| InChI | InChI=1S/C13H27NS/c1-3-4-5-6-7-8-9-10-13-14-11-12(2)15-13/h12-14H,3-11H2,1-2H3 |
| InChIKey | JZNKHQKLZXYVQN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-nonyl-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-nonyl-1,3-thiazolidine?
The IUPAC name of 5-methyl-2-nonyl-1,3-thiazolidine (CID 3087737) is 5-methyl-2-nonyl-1,3-thiazolidine.
What is the SMILES notation for 5-methyl-2-nonyl-1,3-thiazolidine?
The canonical SMILES for 5-methyl-2-nonyl-1,3-thiazolidine is CCCCCCCCCC1NCC(C)S1.
What is the InChIKey of 5-methyl-2-nonyl-1,3-thiazolidine?
The InChIKey is JZNKHQKLZXYVQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NS/c1-3-4-5-6-7-8-9-10-13-14-11-12(2)15-13/h12-14H,3-11H2,1-2H3.
What are the key properties of 5-methyl-2-nonyl-1,3-thiazolidine?
5-methyl-2-nonyl-1,3-thiazolidine has a molecular weight of 229.43 g/mol, XLogP of 4.18, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-nonyl-1,3-thiazolidine is sourced from PubChem (CID 3087737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).