About 5-(4-chlorophenyl)-2,4-diethyl-1,2,4-triazol-3-one
5-(4-chlorophenyl)-2,4-diethyl-1,2,4-triazol-3-one (PubChem CID 3087747) has the molecular formula C12H14ClN3O
and a molecular weight of 251.72 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2,4-diethyl-1,2,4-triazol-3-one.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-2,4-diethyl-1,2,4-triazol-3-one |
| PubChem CID | 3087747 |
| Molecular Formula | C12H14ClN3O |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 5-(4-chlorophenyl)-2,4-diethyl-1,2,4-triazol-3-one |
| SMILES | CCn1nc(-c2ccc(Cl)cc2)n(CC)c1=O |
| InChI | InChI=1S/C12H14ClN3O/c1-3-15-11(14-16(4-2)12(15)17)9-5-7-10(13)8-6-9/h5-8H,3-4H2,1-2H3 |
| InChIKey | GLXNKHITAMTKMO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4-chlorophenyl)-2,4-diethyl-1,2,4-triazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-2,4-diethyl-1,2,4-triazol-3-one?
The IUPAC name of 5-(4-chlorophenyl)-2,4-diethyl-1,2,4-triazol-3-one (CID 3087747) is 5-(4-chlorophenyl)-2,4-diethyl-1,2,4-triazol-3-one.
What is the SMILES notation for 5-(4-chlorophenyl)-2,4-diethyl-1,2,4-triazol-3-one?
The canonical SMILES for 5-(4-chlorophenyl)-2,4-diethyl-1,2,4-triazol-3-one is CCn1nc(-c2ccc(Cl)cc2)n(CC)c1=O.
What is the InChIKey of 5-(4-chlorophenyl)-2,4-diethyl-1,2,4-triazol-3-one?
The InChIKey is GLXNKHITAMTKMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN3O/c1-3-15-11(14-16(4-2)12(15)17)9-5-7-10(13)8-6-9/h5-8H,3-4H2,1-2H3.
What are the key properties of 5-(4-chlorophenyl)-2,4-diethyl-1,2,4-triazol-3-one?
5-(4-chlorophenyl)-2,4-diethyl-1,2,4-triazol-3-one has a molecular weight of 251.72 g/mol, XLogP of 2.40, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-2,4-diethyl-1,2,4-triazol-3-one is sourced from PubChem (CID 3087747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).