C19H20N6O4 — CID 30879445
3,4-diethoxy-N'-[4-(tetrazol-1-yl)benzoyl]benzohydrazide (PubChem CID 30879445) has the molecular formula C19H20N6O4 and a molecular weight of 396.41 g/mol. Its IUPAC name is 3,4-diethoxy-N'-[4-(tetrazol-1-yl)benzoyl]benzohydrazide.
| Compound Name | 3,4-diethoxy-N'-[4-(tetrazol-1-yl)benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 30879445 |
| Molecular Formula | C19H20N6O4 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 3,4-diethoxy-N'-[4-(tetrazol-1-yl)benzoyl]benzohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)c2ccc(-n3cnnn3)cc2)cc1OCC |
| InChI | InChI=1S/C19H20N6O4/c1-3-28-16-10-7-14(11-17(16)29-4-2)19(27)22-21-18(26)13-5-8-15(9-6-13)25-12-20-23-24-25/h5-12H,3-4H2,1-2H3,(H,21,26)(H,22,27) |
| InChIKey | JQZSQPMGMYQCSF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|