About 5-[1-(4H-1,3-benzodioxin-8-yl)ethyl]-1H-imidazole
5-[1-(4H-1,3-benzodioxin-8-yl)ethyl]-1H-imidazole (PubChem CID 3087972) has the molecular formula C13H14N2O2
and a molecular weight of 230.27 g/mol. Its IUPAC name is 5-[1-(4H-1,3-benzodioxin-8-yl)ethyl]-1H-imidazole.
Molecular Properties
| Compound Name | 5-[1-(4H-1,3-benzodioxin-8-yl)ethyl]-1H-imidazole |
| PubChem CID | 3087972 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 5-[1-(4H-1,3-benzodioxin-8-yl)ethyl]-1H-imidazole |
| SMILES | CC(c1cnc[nH]1)c1cccc2c1OCOC2 |
| InChI | InChI=1S/C13H14N2O2/c1-9(12-5-14-7-15-12)11-4-2-3-10-6-16-8-17-13(10)11/h2-5,7,9H,6,8H2,1H3,(H,14,15) |
| InChIKey | LFGWVOWFCKDMGR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[1-(4H-1,3-benzodioxin-8-yl)ethyl]-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(4H-1,3-benzodioxin-8-yl)ethyl]-1H-imidazole?
The IUPAC name of 5-[1-(4H-1,3-benzodioxin-8-yl)ethyl]-1H-imidazole (CID 3087972) is 5-[1-(4H-1,3-benzodioxin-8-yl)ethyl]-1H-imidazole.
What is the SMILES notation for 5-[1-(4H-1,3-benzodioxin-8-yl)ethyl]-1H-imidazole?
The canonical SMILES for 5-[1-(4H-1,3-benzodioxin-8-yl)ethyl]-1H-imidazole is CC(c1cnc[nH]1)c1cccc2c1OCOC2.
What is the InChIKey of 5-[1-(4H-1,3-benzodioxin-8-yl)ethyl]-1H-imidazole?
The InChIKey is LFGWVOWFCKDMGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2/c1-9(12-5-14-7-15-12)11-4-2-3-10-6-16-8-17-13(10)11/h2-5,7,9H,6,8H2,1H3,(H,14,15).
What are the key properties of 5-[1-(4H-1,3-benzodioxin-8-yl)ethyl]-1H-imidazole?
5-[1-(4H-1,3-benzodioxin-8-yl)ethyl]-1H-imidazole has a molecular weight of 230.27 g/mol, XLogP of 2.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(4H-1,3-benzodioxin-8-yl)ethyl]-1H-imidazole is sourced from PubChem (CID 3087972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).