About 3-(2-amino-3,5-dimethylphenyl)-2-[2-(diethylamino)ethyl]-3H-isoindol-1-one;dihydrochloride
3-(2-amino-3,5-dimethylphenyl)-2-[2-(diethylamino)ethyl]-3H-isoindol-1-one;dihydrochloride (PubChem CID 3088046) has the molecular formula C22H31Cl2N3O
and a molecular weight of 424.42 g/mol. Its IUPAC name is 3-(2-amino-3,5-dimethylphenyl)-2-[2-(diethylamino)ethyl]-3H-isoindol-1-one;dihydrochloride.
Molecular Properties
| Compound Name | 3-(2-amino-3,5-dimethylphenyl)-2-[2-(diethylamino)ethyl]-3H-isoindol-1-one;dihydrochloride |
| PubChem CID | 3088046 |
| Molecular Formula | C22H31Cl2N3O |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 3-(2-amino-3,5-dimethylphenyl)-2-[2-(diethylamino)ethyl]-3H-isoindol-1-one;dihydrochloride |
| SMILES | CCN(CC)CCN1C(=O)c2ccccc2C1c1cc(C)cc(C)c1N.Cl.Cl |
| InChI | InChI=1S/C22H29N3O.2ClH/c1-5-24(6-2)11-12-25-21(17-9-7-8-10-18(17)22(25)26)19-14-15(3)13-16(4)20(19)23;;/h7-10,13-14,21H,5-6,11-12,23H2,1-4H3;2*1H |
| InChIKey | VLLZMCLMDVFNBS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-amino-3,5-dimethylphenyl)-2-[2-(diethylamino)ethyl]-3H-isoindol-1-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-3,5-dimethylphenyl)-2-[2-(diethylamino)ethyl]-3H-isoindol-1-one;dihydrochloride?
The IUPAC name of 3-(2-amino-3,5-dimethylphenyl)-2-[2-(diethylamino)ethyl]-3H-isoindol-1-one;dihydrochloride (CID 3088046) is 3-(2-amino-3,5-dimethylphenyl)-2-[2-(diethylamino)ethyl]-3H-isoindol-1-one;dihydrochloride.
What is the SMILES notation for 3-(2-amino-3,5-dimethylphenyl)-2-[2-(diethylamino)ethyl]-3H-isoindol-1-one;dihydrochloride?
The canonical SMILES for 3-(2-amino-3,5-dimethylphenyl)-2-[2-(diethylamino)ethyl]-3H-isoindol-1-one;dihydrochloride is CCN(CC)CCN1C(=O)c2ccccc2C1c1cc(C)cc(C)c1N.Cl.Cl.
What is the InChIKey of 3-(2-amino-3,5-dimethylphenyl)-2-[2-(diethylamino)ethyl]-3H-isoindol-1-one;dihydrochloride?
The InChIKey is VLLZMCLMDVFNBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29N3O.2ClH/c1-5-24(6-2)11-12-25-21(17-9-7-8-10-18(17)22(25)26)19-14-15(3)13-16(4)20(19)23;;/h7-10,13-14,21H,5-6,11-12,23H2,1-4H3;2*1H.
What are the key properties of 3-(2-amino-3,5-dimethylphenyl)-2-[2-(diethylamino)ethyl]-3H-isoindol-1-one;dihydrochloride?
3-(2-amino-3,5-dimethylphenyl)-2-[2-(diethylamino)ethyl]-3H-isoindol-1-one;dihydrochloride has a molecular weight of 424.42 g/mol, XLogP of 4.62, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-3,5-dimethylphenyl)-2-[2-(diethylamino)ethyl]-3H-isoindol-1-one;dihydrochloride is sourced from PubChem (CID 3088046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).