C26H35N3O3 — CID 3088098
8-[4-[4-(2-oxo-1,3-dihydroindol-3-yl)piperidin-1-yl]butyl]-8-azaspiro[4.5]decane-7,9-dione (PubChem CID 3088098) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is 8-[4-[4-(2-oxo-1,3-dihydroindol-3-yl)piperidin-1-yl]butyl]-8-azaspiro[4.5]decane-7,9-dione.
| Compound Name | 8-[4-[4-(2-oxo-1,3-dihydroindol-3-yl)piperidin-1-yl]butyl]-8-azaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 3088098 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 8-[4-[4-(2-oxo-1,3-dihydroindol-3-yl)piperidin-1-yl]butyl]-8-azaspiro[4.5]decane-7,9-dione |
| SMILES | O=C1Nc2ccccc2C1C1CCN(CCCCN2C(=O)CC3(CCCC3)CC2=O)CC1 |
| InChI | InChI=1S/C26H35N3O3/c30-22-17-26(11-3-4-12-26)18-23(31)29(22)14-6-5-13-28-15-9-19(10-16-28)24-20-7-1-2-8-21(20)27-25(24)32/h1-2,7-8,19,24H,3-6,9-18H2,(H,27,32) |
| InChIKey | BZKMGEDLYOKIRJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|