About 3-amino-1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)propan-1-one
3-amino-1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)propan-1-one (PubChem CID 3088170) has the molecular formula C13H26N2O5
and a molecular weight of 290.36 g/mol. Its IUPAC name is 3-amino-1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)propan-1-one.
Molecular Properties
| Compound Name | 3-amino-1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)propan-1-one |
| PubChem CID | 3088170 |
| Molecular Formula | C13H26N2O5 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 3-amino-1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)propan-1-one |
| SMILES | NCCC(=O)N1CCOCCOCCOCCOCC1 |
| InChI | InChI=1S/C13H26N2O5/c14-2-1-13(16)15-3-5-17-7-9-19-11-12-20-10-8-18-6-4-15/h1-12,14H2 |
| InChIKey | UVUJUXGQLFHLEQ-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-amino-1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)propan-1-one?
The IUPAC name of 3-amino-1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)propan-1-one (CID 3088170) is 3-amino-1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)propan-1-one.
What is the SMILES notation for 3-amino-1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)propan-1-one?
The canonical SMILES for 3-amino-1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)propan-1-one is NCCC(=O)N1CCOCCOCCOCCOCC1.
What is the InChIKey of 3-amino-1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)propan-1-one?
The InChIKey is UVUJUXGQLFHLEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O5/c14-2-1-13(16)15-3-5-17-7-9-19-11-12-20-10-8-18-6-4-15/h1-12,14H2.
What are the key properties of 3-amino-1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)propan-1-one?
3-amino-1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)propan-1-one has a molecular weight of 290.36 g/mol, XLogP of -0.76, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)propan-1-one is sourced from PubChem (CID 3088170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).