C17H19N3O2 — CID 3088202
2-(2-methoxyanilino)-5,6,7,8-tetrahydroquinoline-3-carboxamide (PubChem CID 3088202) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 2-(2-methoxyanilino)-5,6,7,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | 2-(2-methoxyanilino)-5,6,7,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 3088202 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-(2-methoxyanilino)-5,6,7,8-tetrahydroquinoline-3-carboxamide |
| SMILES | COc1ccccc1Nc1nc2c(cc1C(N)=O)CCCC2 |
| InChI | InChI=1S/C17H19N3O2/c1-22-15-9-5-4-8-14(15)20-17-12(16(18)21)10-11-6-2-3-7-13(11)19-17/h4-5,8-10H,2-3,6-7H2,1H3,(H2,18,21)(H,19,20) |
| InChIKey | AWRNFTCQQVWBCA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |