About 2-methoxy-2,8-diazaspiro[4.5]decane-1,3-dione;hydrochloride
2-methoxy-2,8-diazaspiro[4.5]decane-1,3-dione;hydrochloride (PubChem CID 3088285) has the molecular formula C9H15ClN2O3
and a molecular weight of 234.68 g/mol. Its IUPAC name is 2-methoxy-2,8-diazaspiro[4.5]decane-1,3-dione;hydrochloride.
Molecular Properties
| Compound Name | 2-methoxy-2,8-diazaspiro[4.5]decane-1,3-dione;hydrochloride |
| PubChem CID | 3088285 |
| Molecular Formula | C9H15ClN2O3 |
| Molecular Weight | 234.68 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-methoxy-2,8-diazaspiro[4.5]decane-1,3-dione;hydrochloride |
| SMILES | CON1C(=O)CC2(CCNCC2)C1=O.Cl |
| InChI | InChI=1S/C9H14N2O3.ClH/c1-14-11-7(12)6-9(8(11)13)2-4-10-5-3-9;/h10H,2-6H2,1H3;1H |
| InChIKey | AQGQDABWRORTCI-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.68 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-2,8-diazaspiro[4.5]decane-1,3-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-2,8-diazaspiro[4.5]decane-1,3-dione;hydrochloride?
The IUPAC name of 2-methoxy-2,8-diazaspiro[4.5]decane-1,3-dione;hydrochloride (CID 3088285) is 2-methoxy-2,8-diazaspiro[4.5]decane-1,3-dione;hydrochloride.
What is the SMILES notation for 2-methoxy-2,8-diazaspiro[4.5]decane-1,3-dione;hydrochloride?
The canonical SMILES for 2-methoxy-2,8-diazaspiro[4.5]decane-1,3-dione;hydrochloride is CON1C(=O)CC2(CCNCC2)C1=O.Cl.
What is the InChIKey of 2-methoxy-2,8-diazaspiro[4.5]decane-1,3-dione;hydrochloride?
The InChIKey is AQGQDABWRORTCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3.ClH/c1-14-11-7(12)6-9(8(11)13)2-4-10-5-3-9;/h10H,2-6H2,1H3;1H.
What are the key properties of 2-methoxy-2,8-diazaspiro[4.5]decane-1,3-dione;hydrochloride?
2-methoxy-2,8-diazaspiro[4.5]decane-1,3-dione;hydrochloride has a molecular weight of 234.68 g/mol, XLogP of 0.10, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-2,8-diazaspiro[4.5]decane-1,3-dione;hydrochloride is sourced from PubChem (CID 3088285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).