About [4-tert-butyl-3-[3-(dimethylamino)propoxy]phenyl] N,N-dimethylcarbamate;hydrochloride
[4-tert-butyl-3-[3-(dimethylamino)propoxy]phenyl] N,N-dimethylcarbamate;hydrochloride (PubChem CID 3088520) has the molecular formula C18H31ClN2O3
and a molecular weight of 358.91 g/mol. Its IUPAC name is [4-tert-butyl-3-[3-(dimethylamino)propoxy]phenyl] N,N-dimethylcarbamate;hydrochloride.
Molecular Properties
| Compound Name | [4-tert-butyl-3-[3-(dimethylamino)propoxy]phenyl] N,N-dimethylcarbamate;hydrochloride |
| PubChem CID | 3088520 |
| Molecular Formula | C18H31ClN2O3 |
| Molecular Weight | 358.91 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | [4-tert-butyl-3-[3-(dimethylamino)propoxy]phenyl] N,N-dimethylcarbamate;hydrochloride |
| SMILES | CN(C)CCCOc1cc(OC(=O)N(C)C)ccc1C(C)(C)C.Cl |
| InChI | InChI=1S/C18H30N2O3.ClH/c1-18(2,3)15-10-9-14(23-17(21)20(6)7)13-16(15)22-12-8-11-19(4)5;/h9-10,13H,8,11-12H2,1-7H3;1H |
| InChIKey | IQSFFGWPLDJDRF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.91 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [4-tert-butyl-3-[3-(dimethylamino)propoxy]phenyl] N,N-dimethylcarbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-tert-butyl-3-[3-(dimethylamino)propoxy]phenyl] N,N-dimethylcarbamate;hydrochloride?
The IUPAC name of [4-tert-butyl-3-[3-(dimethylamino)propoxy]phenyl] N,N-dimethylcarbamate;hydrochloride (CID 3088520) is [4-tert-butyl-3-[3-(dimethylamino)propoxy]phenyl] N,N-dimethylcarbamate;hydrochloride.
What is the SMILES notation for [4-tert-butyl-3-[3-(dimethylamino)propoxy]phenyl] N,N-dimethylcarbamate;hydrochloride?
The canonical SMILES for [4-tert-butyl-3-[3-(dimethylamino)propoxy]phenyl] N,N-dimethylcarbamate;hydrochloride is CN(C)CCCOc1cc(OC(=O)N(C)C)ccc1C(C)(C)C.Cl.
What is the InChIKey of [4-tert-butyl-3-[3-(dimethylamino)propoxy]phenyl] N,N-dimethylcarbamate;hydrochloride?
The InChIKey is IQSFFGWPLDJDRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N2O3.ClH/c1-18(2,3)15-10-9-14(23-17(21)20(6)7)13-16(15)22-12-8-11-19(4)5;/h9-10,13H,8,11-12H2,1-7H3;1H.
What are the key properties of [4-tert-butyl-3-[3-(dimethylamino)propoxy]phenyl] N,N-dimethylcarbamate;hydrochloride?
[4-tert-butyl-3-[3-(dimethylamino)propoxy]phenyl] N,N-dimethylcarbamate;hydrochloride has a molecular weight of 358.91 g/mol, XLogP of 3.80, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-tert-butyl-3-[3-(dimethylamino)propoxy]phenyl] N,N-dimethylcarbamate;hydrochloride is sourced from PubChem (CID 3088520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).