About 1,1-dibromo-2-phenyl-1lambda4,3-benzotellurazole
1,1-dibromo-2-phenyl-1lambda4,3-benzotellurazole (PubChem CID 3088544) has the molecular formula C13H9Br2NTe
and a molecular weight of 466.63 g/mol. Its IUPAC name is 1,1-dibromo-2-phenyl-1lambda4,3-benzotellurazole.
Molecular Properties
| Compound Name | 1,1-dibromo-2-phenyl-1lambda4,3-benzotellurazole |
| PubChem CID | 3088544 |
| Molecular Formula | C13H9Br2NTe |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.82 |
| IUPAC Name | 1,1-dibromo-2-phenyl-1lambda4,3-benzotellurazole |
| SMILES | Br[Te]1(Br)C(c2ccccc2)=Nc2ccccc21 |
| InChI | InChI=1S/C13H9Br2NTe/c14-17(15)12-9-5-4-8-11(12)16-13(17)10-6-2-1-3-7-10/h1-9H |
| InChIKey | ZUWBETZAUBBRPY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dibromo-2-phenyl-1lambda4,3-benzotellurazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dibromo-2-phenyl-1lambda4,3-benzotellurazole?
The IUPAC name of 1,1-dibromo-2-phenyl-1lambda4,3-benzotellurazole (CID 3088544) is 1,1-dibromo-2-phenyl-1lambda4,3-benzotellurazole.
What is the SMILES notation for 1,1-dibromo-2-phenyl-1lambda4,3-benzotellurazole?
The canonical SMILES for 1,1-dibromo-2-phenyl-1lambda4,3-benzotellurazole is Br[Te]1(Br)C(c2ccccc2)=Nc2ccccc21.
What is the InChIKey of 1,1-dibromo-2-phenyl-1lambda4,3-benzotellurazole?
The InChIKey is ZUWBETZAUBBRPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Br2NTe/c14-17(15)12-9-5-4-8-11(12)16-13(17)10-6-2-1-3-7-10/h1-9H.
What are the key properties of 1,1-dibromo-2-phenyl-1lambda4,3-benzotellurazole?
1,1-dibromo-2-phenyl-1lambda4,3-benzotellurazole has a molecular weight of 466.63 g/mol, XLogP of 3.80, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dibromo-2-phenyl-1lambda4,3-benzotellurazole is sourced from PubChem (CID 3088544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).