C21H24N4O4 — CID 3088576
2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[2-(2-hydroxyethylamino)ethyl]acetamide (PubChem CID 3088576) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[2-(2-hydroxyethylamino)ethyl]acetamide.
| Compound Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[2-(2-hydroxyethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 3088576 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[2-(2-hydroxyethylamino)ethyl]acetamide |
| SMILES | O=C(CN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O)NCCNCCO |
| InChI | InChI=1S/C21H24N4O4/c26-14-13-22-11-12-23-18(27)15-25-19(28)21(24-20(25)29,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,22,26H,11-15H2,(H,23,27)(H,24,29) |
| InChIKey | PYNMGRLDQINSEB-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|