C13H20N6OS — CID 3088603
N-cyclopentyl-2-(diaminomethylideneamino)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxamide (PubChem CID 3088603) has the molecular formula C13H20N6OS and a molecular weight of 308.41 g/mol. Its IUPAC name is N-cyclopentyl-2-(diaminomethylideneamino)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxamide.
| Compound Name | N-cyclopentyl-2-(diaminomethylideneamino)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 3088603 |
| Molecular Formula | C13H20N6OS |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | N-cyclopentyl-2-(diaminomethylideneamino)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxamide |
| SMILES | NC(N)=Nc1nc2c(s1)CN(C(=O)NC1CCCC1)CC2 |
| InChI | InChI=1S/C13H20N6OS/c14-11(15)18-12-17-9-5-6-19(7-10(9)21-12)13(20)16-8-3-1-2-4-8/h8H,1-7H2,(H,16,20)(H4,14,15,17,18) |
| InChIKey | RNHOTVRMOXKBBZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|