C13H23N7OS — CID 3088605
1-[2-[2-(diaminomethylideneamino)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]ethyl]-3-propan-2-ylurea (PubChem CID 3088605) has the molecular formula C13H23N7OS and a molecular weight of 325.44 g/mol. Its IUPAC name is 1-[2-[2-(diaminomethylideneamino)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]ethyl]-3-propan-2-ylurea.
| Compound Name | 1-[2-[2-(diaminomethylideneamino)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]ethyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 3088605 |
| Molecular Formula | C13H23N7OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 1-[2-[2-(diaminomethylideneamino)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]ethyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NCCN1CCc2nc(N=C(N)N)sc2C1 |
| InChI | InChI=1S/C13H23N7OS/c1-8(2)17-12(21)16-4-6-20-5-3-9-10(7-20)22-13(18-9)19-11(14)15/h8H,3-7H2,1-2H3,(H2,16,17,21)(H4,14,15,18,19) |
| InChIKey | IMVWSNKQMHWFDU-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 121.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|