About N-(2-morpholin-4-ylethyl)-4-phenyl-1,3-thiazol-2-amine;dihydrochloride
N-(2-morpholin-4-ylethyl)-4-phenyl-1,3-thiazol-2-amine;dihydrochloride (PubChem CID 3088646) has the molecular formula C15H21Cl2N3OS
and a molecular weight of 362.33 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-4-phenyl-1,3-thiazol-2-amine;dihydrochloride.
Molecular Properties
| Compound Name | N-(2-morpholin-4-ylethyl)-4-phenyl-1,3-thiazol-2-amine;dihydrochloride |
| PubChem CID | 3088646 |
| Molecular Formula | C15H21Cl2N3OS |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-4-phenyl-1,3-thiazol-2-amine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(-c2csc(NCCN3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C15H19N3OS.2ClH/c1-2-4-13(5-3-1)14-12-20-15(17-14)16-6-7-18-8-10-19-11-9-18;;/h1-5,12H,6-11H2,(H,16,17);2*1H |
| InChIKey | GBUZVNVXTKNABN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-morpholin-4-ylethyl)-4-phenyl-1,3-thiazol-2-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-morpholin-4-ylethyl)-4-phenyl-1,3-thiazol-2-amine;dihydrochloride?
The IUPAC name of N-(2-morpholin-4-ylethyl)-4-phenyl-1,3-thiazol-2-amine;dihydrochloride (CID 3088646) is N-(2-morpholin-4-ylethyl)-4-phenyl-1,3-thiazol-2-amine;dihydrochloride.
What is the SMILES notation for N-(2-morpholin-4-ylethyl)-4-phenyl-1,3-thiazol-2-amine;dihydrochloride?
The canonical SMILES for N-(2-morpholin-4-ylethyl)-4-phenyl-1,3-thiazol-2-amine;dihydrochloride is Cl.Cl.c1ccc(-c2csc(NCCN3CCOCC3)n2)cc1.
What is the InChIKey of N-(2-morpholin-4-ylethyl)-4-phenyl-1,3-thiazol-2-amine;dihydrochloride?
The InChIKey is GBUZVNVXTKNABN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3OS.2ClH/c1-2-4-13(5-3-1)14-12-20-15(17-14)16-6-7-18-8-10-19-11-9-18;;/h1-5,12H,6-11H2,(H,16,17);2*1H.
What are the key properties of N-(2-morpholin-4-ylethyl)-4-phenyl-1,3-thiazol-2-amine;dihydrochloride?
N-(2-morpholin-4-ylethyl)-4-phenyl-1,3-thiazol-2-amine;dihydrochloride has a molecular weight of 362.33 g/mol, XLogP of 3.40, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-morpholin-4-ylethyl)-4-phenyl-1,3-thiazol-2-amine;dihydrochloride is sourced from PubChem (CID 3088646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).