C10H13N5OS — CID 3088766
8-amino-3-methyl-1-propyl-6-sulfanylidenepyrimido[1,6-b][1,2,4]triazin-2-one (PubChem CID 3088766) has the molecular formula C10H13N5OS and a molecular weight of 251.31 g/mol. Its IUPAC name is 8-amino-3-methyl-1-propyl-6-sulfanylidenepyrimido[1,6-b][1,2,4]triazin-2-one.
| Compound Name | 8-amino-3-methyl-1-propyl-6-sulfanylidenepyrimido[1,6-b][1,2,4]triazin-2-one |
|---|---|
| PubChem CID | 3088766 |
| Molecular Formula | C10H13N5OS |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 8-amino-3-methyl-1-propyl-6-sulfanylidenepyrimido[1,6-b][1,2,4]triazin-2-one |
| SMILES | CCCn1c(=O)c(C)nn2c(=S)nc(N)cc12 |
| InChI | InChI=1S/C10H13N5OS/c1-3-4-14-8-5-7(11)12-10(17)15(8)13-6(2)9(14)16/h5H,3-4H2,1-2H3,(H2,11,12,17) |
| InChIKey | NHPXXGIXUASUCT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|