About (3R,4S)-3-[(dimethylamino)methyl]-4-(4-methoxyphenyl)thian-4-ol;hydrochloride
(3R,4S)-3-[(dimethylamino)methyl]-4-(4-methoxyphenyl)thian-4-ol;hydrochloride (PubChem CID 3088842) has the molecular formula C15H24ClNO2S
and a molecular weight of 317.88 g/mol. Its IUPAC name is (3R,4S)-3-[(dimethylamino)methyl]-4-(4-methoxyphenyl)thian-4-ol;hydrochloride.
Molecular Properties
| Compound Name | (3R,4S)-3-[(dimethylamino)methyl]-4-(4-methoxyphenyl)thian-4-ol;hydrochloride |
| PubChem CID | 3088842 |
| Molecular Formula | C15H24ClNO2S |
| Molecular Weight | 317.88 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (3R,4S)-3-[(dimethylamino)methyl]-4-(4-methoxyphenyl)thian-4-ol;hydrochloride |
| SMILES | COc1ccc([C@]2(O)CCSC[C@@H]2CN(C)C)cc1.Cl |
| InChI | InChI=1S/C15H23NO2S.ClH/c1-16(2)10-13-11-19-9-8-15(13,17)12-4-6-14(18-3)7-5-12;/h4-7,13,17H,8-11H2,1-3H3;1H/t13-,15+;/m0./s1 |
| InChIKey | XHSBYNDCVCGGQC-NQQJLSKUSA-N |
| XLogP | 2.62 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.88 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R,4S)-3-[(dimethylamino)methyl]-4-(4-methoxyphenyl)thian-4-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-3-[(dimethylamino)methyl]-4-(4-methoxyphenyl)thian-4-ol;hydrochloride?
The IUPAC name of (3R,4S)-3-[(dimethylamino)methyl]-4-(4-methoxyphenyl)thian-4-ol;hydrochloride (CID 3088842) is (3R,4S)-3-[(dimethylamino)methyl]-4-(4-methoxyphenyl)thian-4-ol;hydrochloride.
What is the SMILES notation for (3R,4S)-3-[(dimethylamino)methyl]-4-(4-methoxyphenyl)thian-4-ol;hydrochloride?
The canonical SMILES for (3R,4S)-3-[(dimethylamino)methyl]-4-(4-methoxyphenyl)thian-4-ol;hydrochloride is COc1ccc([C@]2(O)CCSC[C@@H]2CN(C)C)cc1.Cl.
What is the InChIKey of (3R,4S)-3-[(dimethylamino)methyl]-4-(4-methoxyphenyl)thian-4-ol;hydrochloride?
The InChIKey is XHSBYNDCVCGGQC-NQQJLSKUSA-N. The full InChI is InChI=1S/C15H23NO2S.ClH/c1-16(2)10-13-11-19-9-8-15(13,17)12-4-6-14(18-3)7-5-12;/h4-7,13,17H,8-11H2,1-3H3;1H/t13-,15+;/m0./s1.
What are the key properties of (3R,4S)-3-[(dimethylamino)methyl]-4-(4-methoxyphenyl)thian-4-ol;hydrochloride?
(3R,4S)-3-[(dimethylamino)methyl]-4-(4-methoxyphenyl)thian-4-ol;hydrochloride has a molecular weight of 317.88 g/mol, XLogP of 2.62, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-3-[(dimethylamino)methyl]-4-(4-methoxyphenyl)thian-4-ol;hydrochloride is sourced from PubChem (CID 3088842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).