C19H20N4O4S — CID 30889361
N-methyl-2-[[2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]acetyl]amino]benzamide (PubChem CID 30889361) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is N-methyl-2-[[2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]acetyl]amino]benzamide.
| Compound Name | N-methyl-2-[[2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 30889361 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-methyl-2-[[2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]acetyl]amino]benzamide |
| SMILES | CNC(=O)c1ccccc1NC(=O)Cn1c(CS(C)(=O)=O)nc2ccccc21 |
| InChI | InChI=1S/C19H20N4O4S/c1-20-19(25)13-7-3-4-8-14(13)22-18(24)11-23-16-10-6-5-9-15(16)21-17(23)12-28(2,26)27/h3-10H,11-12H2,1-2H3,(H,20,25)(H,22,24) |
| InChIKey | NLADOLYLMCRMHV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |