About N-[4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butylsulfonyl]acetamide
N-[4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butylsulfonyl]acetamide (PubChem CID 3089090) has the molecular formula C16H22Cl2N3O3S+
and a molecular weight of 407.34 g/mol. Its IUPAC name is N-[4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butylsulfonyl]acetamide.
Molecular Properties
| Compound Name | N-[4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butylsulfonyl]acetamide |
| PubChem CID | 3089090 |
| Molecular Formula | C16H22Cl2N3O3S+ |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | N-[4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butylsulfonyl]acetamide |
| SMILES | CCn1c(C)[n+](CCCCS(=O)(=O)NC(C)=O)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C16H21Cl2N3O3S/c1-4-20-12(3)21(16-10-14(18)13(17)9-15(16)20)7-5-6-8-25(23,24)19-11(2)22/h9-10H,4-8H2,1-3H3/p+1 |
| InChIKey | GIGQQTQTQSDXAV-UHFFFAOYSA-O |
| XLogP | 2.81 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butylsulfonyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butylsulfonyl]acetamide?
The IUPAC name of N-[4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butylsulfonyl]acetamide (CID 3089090) is N-[4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butylsulfonyl]acetamide.
What is the SMILES notation for N-[4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butylsulfonyl]acetamide?
The canonical SMILES for N-[4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butylsulfonyl]acetamide is CCn1c(C)[n+](CCCCS(=O)(=O)NC(C)=O)c2cc(Cl)c(Cl)cc21.
What is the InChIKey of N-[4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butylsulfonyl]acetamide?
The InChIKey is GIGQQTQTQSDXAV-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H21Cl2N3O3S/c1-4-20-12(3)21(16-10-14(18)13(17)9-15(16)20)7-5-6-8-25(23,24)19-11(2)22/h9-10H,4-8H2,1-3H3/p+1.
What are the key properties of N-[4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butylsulfonyl]acetamide?
N-[4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butylsulfonyl]acetamide has a molecular weight of 407.34 g/mol, XLogP of 2.81, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butylsulfonyl]acetamide is sourced from PubChem (CID 3089090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).